CAS 1198413-08-9 is the registry number for 9-Bromo-pyrido[1,2-a]pyrimidin-4-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
9-bromopyrido[1,2-a]pyrimidin-4-one (CAS 1198413-08-9) is a chemical compound with the molecular formula C8H5BrN2O and a molecular weight of 225.04 g/mol. IUPAC name: 9-bromopyrido[1,2-a]pyrimidin-4-one. InChIKey: SNZILTAAWFDDTF-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O |
|---|---|
| Molecular weight | 225.04 g/mol |
| IUPAC name | 9-bromopyrido[1,2-a]pyrimidin-4-one |
| InChIKey | SNZILTAAWFDDTF-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=O)C=CN=C2C(=C1)Br |
Computed by PubChem (NCBI)