CAS 19419-09-1 appears in our catalog under these names: 3-Bromocinnolin-4-ol, 95%, 3-Bromocinnolin-4-ol 95+%, 3-Bromocinnolin-4-ol, 95+%, 95+%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
3-bromo-1H-cinnolin-4-one (CAS 19419-09-1) is a chemical compound with the molecular formula C8H5BrN2O and a molecular weight of 225.04 g/mol. IUPAC name: 3-bromo-1H-cinnolin-4-one. InChIKey: TZRVSTXNTMEAGB-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O |
|---|---|
| Molecular weight | 225.04 g/mol |
| IUPAC name | 3-bromo-1H-cinnolin-4-one |
| InChIKey | TZRVSTXNTMEAGB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(=NN2)Br |
Computed by PubChem (NCBI)