cas: 1333255-21-2 — see every product listed under this CAS number, including other names
8-Bromo-2-methylquinoline-3-carboxylic acid ethyl ester, 98%, 98% (CAS 1333255-21-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FGT1-100mg |
| cas | 1333255-21-2 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 160.40 Pln | |
| Chemat | 250mg | 294.80 Pln | |
| Chemat | 1g | 981.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 8-bromo-2-methylquinoline-3-carboxylate (CAS 1333255-21-2) is a chemical compound with the molecular formula C13H12BrNO2 and a molecular weight of 294.14 g/mol. IUPAC name: ethyl 8-bromo-2-methylquinoline-3-carboxylate. InChIKey: TUMQMWIVAZEEMS-UHFFFAOYSA-N.
| Molecular formula | C13H12BrNO2 |
|---|---|
| Molecular weight | 294.14 g/mol |
| IUPAC name | ethyl 8-bromo-2-methylquinoline-3-carboxylate |
| InChIKey | TUMQMWIVAZEEMS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C2C(=C1)C=CC=C2Br)C |
Computed by PubChem (NCBI)