Products 1956327-64-2
CAS 1956327-64-2 appears in our catalog under these names: Methyl 4-bromo-1-cyclopropyl-1h-indole-6-carboxylate, 95%, Methyl 4–bromo–1–cyclopropyl–1H–indole–6–carboxylate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
Methyl 4-bromo-1-cyclopropylindole-6-carboxylate (CAS 1956327-64-2) is a chemical compound with the molecular formula C13H12BrNO2 and a molecular weight of 294.14 g/mol. IUPAC name: methyl 4-bromo-1-cyclopropylindole-6-carboxylate. InChIKey: FRZITHSVIJWJMF-UHFFFAOYSA-N.
| Molecular formula | C13H12BrNO2 |
|---|---|
| Molecular weight | 294.14 g/mol |
| IUPAC name | methyl 4-bromo-1-cyclopropylindole-6-carboxylate |
| InChIKey | FRZITHSVIJWJMF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=CN2C3CC3)C(=C1)Br |
Computed by PubChem (NCBI)