Products 1563069-87-3
CAS 1563069-87-3 is the registry number for 1-(5-Bromo-1-benzofuran-2-yl)-3-(dimethylamino)prop-2-en-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(E)-1-(5-bromo-1-benzofuran-2-yl)-3-(dimethylamino)prop-2-en-1-one (CAS 1563069-87-3) is a chemical compound with the molecular formula C13H12BrNO2 and a molecular weight of 294.14 g/mol. IUPAC name: (E)-1-(5-bromo-1-benzofuran-2-yl)-3-(dimethylamino)prop-2-en-1-one. InChIKey: UFYBYIOGVPOGCO-AATRIKPKSA-N.
| Molecular formula | C13H12BrNO2 |
|---|---|
| Molecular weight | 294.14 g/mol |
| IUPAC name | (E)-1-(5-bromo-1-benzofuran-2-yl)-3-(dimethylamino)prop-2-en-1-one |
| InChIKey | UFYBYIOGVPOGCO-AATRIKPKSA-N |
| SMILES | CN(C)/C=C/C(=O)C1=CC2=C(O1)C=CC(=C2)Br |
Computed by PubChem (NCBI)