cas: 651735-60-3 — see every product listed under this CAS number, including other names
8-Bromo-3,4-dihydro-2H-naphthalen-1-one, 95% (CAS 651735-60-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F040715-100MG |
| cas | 651735-60-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 128.10 Pln | |
| Fluorochem | 250mg | 206.20 Pln | |
| Fluorochem | 1g | 565.44 Pln | |
| Fluorochem | 5g | 2106.57 Pln | |
| Fluorochem | 10g | 3715.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
8-bromo-3,4-dihydro-2H-naphthalen-1-one (CAS 651735-60-3) is a chemical compound with the molecular formula C10H9BrO and a molecular weight of 225.08 g/mol. IUPAC name: 8-bromo-3,4-dihydro-2H-naphthalen-1-one. InChIKey: DIYWCGZFCFYCIE-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO |
|---|---|
| Molecular weight | 225.08 g/mol |
| IUPAC name | 8-bromo-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | DIYWCGZFCFYCIE-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=O)C1)C(=CC=C2)Br |
Computed by PubChem (NCBI)