CAS 2351094-67-0 appears in our catalog under these names: 8-Bromo-5-chloro-7-methylimidazo[1,2-c]pyrimidine, 95%, 95%, 8-Bromo-5-chloro-7-methylimidazo[1,2-c]pyrimidine, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
8-bromo-5-chloro-7-methylimidazo[1,2-c]pyrimidine (CAS 2351094-67-0) is a chemical compound with the molecular formula C7H5BrClN3 and a molecular weight of 246.49 g/mol. IUPAC name: 8-bromo-5-chloro-7-methylimidazo[1,2-c]pyrimidine. InChIKey: CWMWZGDKBJDCPP-UHFFFAOYSA-N.
| Molecular formula | C7H5BrClN3 |
|---|---|
| Molecular weight | 246.49 g/mol |
| IUPAC name | 8-bromo-5-chloro-7-methylimidazo[1,2-c]pyrimidine |
| InChIKey | CWMWZGDKBJDCPP-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=NC=CN2C(=N1)Cl)Br |
Computed by PubChem (NCBI)