CAS 1956327-66-4 is the registry number for 6-Bromo-3-chloro-2-methylimidazo[1,2-a]pyrimidine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
6-bromo-3-chloro-2-methylimidazo[1,2-a]pyrimidine (CAS 1956327-66-4) is a chemical compound with the molecular formula C7H5BrClN3 and a molecular weight of 246.49 g/mol. IUPAC name: 6-bromo-3-chloro-2-methylimidazo[1,2-a]pyrimidine. InChIKey: CINYPTREJWMTEL-UHFFFAOYSA-N.
| Molecular formula | C7H5BrClN3 |
|---|---|
| Molecular weight | 246.49 g/mol |
| IUPAC name | 6-bromo-3-chloro-2-methylimidazo[1,2-a]pyrimidine |
| InChIKey | CINYPTREJWMTEL-UHFFFAOYSA-N |
| SMILES | CC1=C(N2C=C(C=NC2=N1)Br)Cl |
Computed by PubChem (NCBI)