CAS 1823372-38-8 is the registry number for 2-Bromo-8-chloro-6-methyl-[1,2,4]triazolo[1,5-a]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
2-bromo-8-chloro-6-methyl-[1,2,4]triazolo[1,5-a]pyridine (CAS 1823372-38-8) is a chemical compound with the molecular formula C7H5BrClN3 and a molecular weight of 246.49 g/mol. IUPAC name: 2-bromo-8-chloro-6-methyl-[1,2,4]triazolo[1,5-a]pyridine. InChIKey: QADFAKOHTXIJDT-UHFFFAOYSA-N.
| Molecular formula | C7H5BrClN3 |
|---|---|
| Molecular weight | 246.49 g/mol |
| IUPAC name | 2-bromo-8-chloro-6-methyl-[1,2,4]triazolo[1,5-a]pyridine |
| InChIKey | QADFAKOHTXIJDT-UHFFFAOYSA-N |
| SMILES | CC1=CN2C(=NC(=N2)Br)C(=C1)Cl |
Computed by PubChem (NCBI)