cas: 1420790-22-2 — see every product listed under this CAS number, including other names
8-Bromo-7-fluoroquinoline, 97% (CAS 1420790-22-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A148911-5g |
| cas | 1420790-22-2 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 15563.80 Pln | |
| Fluorochem | 100mg | 529.00 Pln | |
| Fluorochem | 250mg | 846.59 Pln | |
| Fluorochem | 1g | 1903.51 Pln | |
| Fluorochem | 5g | 5220.05 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
8-bromo-7-fluoroquinoline (CAS 1420790-22-2) is a chemical compound with the molecular formula C9H5BrFN and a molecular weight of 226.04 g/mol. IUPAC name: 8-bromo-7-fluoroquinoline. InChIKey: MEZVXGUTJUGURY-UHFFFAOYSA-N.
| Molecular formula | C9H5BrFN |
|---|---|
| Molecular weight | 226.04 g/mol |
| IUPAC name | 8-bromo-7-fluoroquinoline |
| InChIKey | MEZVXGUTJUGURY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C(C=C2)F)Br)N=C1 |
Computed by PubChem (NCBI)