cas: 1232038-99-1 — see every product listed under this CAS number, including other names
8-Bromoimidazo[1,2-a]pyridine-3-carbaldehyde 97% (CAS 1232038-99-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A839784-100mg |
| cas | 1232038-99-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 342.56 Pln | |
| Ambeed | 250mg | 442.69 Pln | |
| Ambeed | 1g | 960.00 Pln | |
| Ambeed | 5g | 2890.19 Pln | |
| Ambeed | 10g | 5699.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A839784 |
8-bromoimidazo[1,2-a]pyridine-3-carbaldehyde (CAS 1232038-99-1) is a chemical compound with the molecular formula C8H5BrN2O and a molecular weight of 225.04 g/mol. IUPAC name: 8-bromoimidazo[1,2-a]pyridine-3-carbaldehyde. InChIKey: UPVVPSKLFGVMEI-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O |
|---|---|
| Molecular weight | 225.04 g/mol |
| IUPAC name | 8-bromoimidazo[1,2-a]pyridine-3-carbaldehyde |
| InChIKey | UPVVPSKLFGVMEI-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=CN=C2C(=C1)Br)C=O |
Computed by PubChem (NCBI)