cas: 1260657-19-9 — see every product listed under this CAS number, including other names
8-Bromoquinazolin-4-amine, 97% (CAS 1260657-19-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 2.5g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F211197-250MG |
| cas | 1260657-19-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 185.37 Pln | |
| Fluorochem | 500mg | 284.29 Pln | |
| Fluorochem | 1g | 372.80 Pln | |
| Fluorochem | 2.5g | 846.59 Pln | |
| Fluorochem | 5g | 1544.27 Pln | |
| Fluorochem | 10g | 3033.32 Pln | |
| Fluorochem | 25g | 7484.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
8-bromoquinazolin-4-amine (CAS 1260657-19-9) is a chemical compound with the molecular formula C8H6BrN3 and a molecular weight of 224.06 g/mol. IUPAC name: 8-bromoquinazolin-4-amine. InChIKey: FOIJNKOSXGBMCY-UHFFFAOYSA-N.
| Molecular formula | C8H6BrN3 |
|---|---|
| Molecular weight | 224.06 g/mol |
| IUPAC name | 8-bromoquinazolin-4-amine |
| InChIKey | FOIJNKOSXGBMCY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)N=CN=C2N |
Computed by PubChem (NCBI)