8-Bromoquinolin-2-amine, 95%
cas: 1092304-85-2 — see every product listed under this CAS number, including other names
8-Bromoquinolin-2-amine, 95% (CAS 1092304-85-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 10g, 5g, 100mg. Offered by: Combi-blocks, Ambeed, Chemat, BLDpharm.
| brand | Combi-blocks |
|---|---|
| catalog number | QK-6102-250mg |
| cas | 1092304-85-2 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 5g | price on request | |
| Ambeed | 100mg | 286.94 Pln | |
| Ambeed | 250mg | 337.00 Pln | |
| Ambeed | 1g | 626.25 Pln | |
| Ambeed | 5g | 1761.00 Pln | |
| Ambeed | 10g | 2873.50 Pln | |
| Chemat | 100mg | 299.60 Pln | |
| Chemat | 250mg | 438.80 Pln | |
| Chemat | 1g | 995.60 Pln | |
| Chemat | 5g | 2867.60 Pln | |
| Chemat | 10g | 4739.60 Pln | |
| BLDpharm | 100mg | 303.25 Pln | |
| BLDpharm | 250mg | 353.23 Pln | |
| BLDpharm | 1g | 669.79 Pln | |
| BLDpharm | 5g | 2241.46 Pln | |
| BLDpharm | 10g | 4390.70 Pln | |
| Fluorochem | 250mg | 794.53 Pln | |
| Fluorochem | 1g | 1835.83 Pln | |
| Fluorochem | 5g | 5318.98 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
8-bromoquinolin-2-amine (CAS 1092304-85-2) is a chemical compound with the molecular formula C9H7BrN2 and a molecular weight of 223.07 g/mol. IUPAC name: 8-bromoquinolin-2-amine. InChIKey: JCZCFNGKDJIKQI-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2 |
|---|---|
| Molecular weight | 223.07 g/mol |
| IUPAC name | 8-bromoquinolin-2-amine |
| InChIKey | JCZCFNGKDJIKQI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)N=C(C=C2)N |
Computed by PubChem (NCBI)