cas: 59134-89-3 — see every product listed under this CAS number, including other names
8-Chloro-[1,3]dioxolo[4,5-g]quinoline 95% (CAS 59134-89-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A220152-100mg |
| cas | 59134-89-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 587.31 Pln | |
| Ambeed | 250mg | 776.44 Pln | |
| Ambeed | 1g | 1816.62 Pln | |
| Ambeed | 5g | 6149.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A220152 |
8-chloro-[1,3]dioxolo[4,5-g]quinoline (CAS 59134-89-3) is a chemical compound with the molecular formula C10H6ClNO2 and a molecular weight of 207.61 g/mol. IUPAC name: 8-chloro-[1,3]dioxolo[4,5-g]quinoline. InChIKey: GRUBPJPDFFLKQE-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO2 |
|---|---|
| Molecular weight | 207.61 g/mol |
| IUPAC name | 8-chloro-[1,3]dioxolo[4,5-g]quinoline |
| InChIKey | GRUBPJPDFFLKQE-UHFFFAOYSA-N |
| SMILES | C1OC2=CC3=C(C=CN=C3C=C2O1)Cl |
Computed by PubChem (NCBI)