cas: 59134-89-3 — see every product listed under this CAS number, including other names
8-Chloro-[1,3]dioxolo[4,5-g]quinoline, 95%, 95% (CAS 59134-89-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EFRJ-100mg |
| cas | 59134-89-3 |
| size | 100mg |
| availability | 6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 501.20 Pln | |
| Chemat | 250mg | 717.20 Pln | |
| Chemat | 1g | 1638.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
8-chloro-[1,3]dioxolo[4,5-g]quinoline (CAS 59134-89-3) is a chemical compound with the molecular formula C10H6ClNO2 and a molecular weight of 207.61 g/mol. IUPAC name: 8-chloro-[1,3]dioxolo[4,5-g]quinoline. InChIKey: GRUBPJPDFFLKQE-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO2 |
|---|---|
| Molecular weight | 207.61 g/mol |
| IUPAC name | 8-chloro-[1,3]dioxolo[4,5-g]quinoline |
| InChIKey | GRUBPJPDFFLKQE-UHFFFAOYSA-N |
| SMILES | C1OC2=CC3=C(C=CN=C3C=C2O1)Cl |
Computed by PubChem (NCBI)