cas: 176637-10-8 — see every product listed under this CAS number, including other names
8-Chloro-2-(methylthio)pyrimido[5,4-d]pyrimidine 95% (CAS 176637-10-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A745879-1g |
| cas | 176637-10-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 526.12 Pln | |
| Ambeed | 10g | 2350.62 Pln | |
| Ambeed | 25g | 4625.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A745879 |
4-chloro-6-methylsulfanylpyrimido[5,4-d]pyrimidine (CAS 176637-10-8) is a chemical compound with the molecular formula C7H5ClN4S and a molecular weight of 212.66 g/mol. IUPAC name: 4-chloro-6-methylsulfanylpyrimido[5,4-d]pyrimidine. InChIKey: YBAUXEUJXJTKCH-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN4S |
|---|---|
| Molecular weight | 212.66 g/mol |
| IUPAC name | 4-chloro-6-methylsulfanylpyrimido[5,4-d]pyrimidine |
| InChIKey | YBAUXEUJXJTKCH-UHFFFAOYSA-N |
| SMILES | CSC1=NC=C2C(=N1)C(=NC=N2)Cl |
Computed by PubChem (NCBI)