cas: 176637-10-8 — see every product listed under this CAS number, including other names
8-Chloro-2-(methylthio)pyrimido[5,4-d]pyrimidine, 97% (CAS 176637-10-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F240184-1G |
| cas | 176637-10-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 185.37 Pln | |
| Fluorochem | 5g | 482.14 Pln | |
| Fluorochem | 10g | 883.04 Pln | |
| Fluorochem | 25g | 1851.45 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-chloro-6-methylsulfanylpyrimido[5,4-d]pyrimidine (CAS 176637-10-8) is a chemical compound with the molecular formula C7H5ClN4S and a molecular weight of 212.66 g/mol. IUPAC name: 4-chloro-6-methylsulfanylpyrimido[5,4-d]pyrimidine. InChIKey: YBAUXEUJXJTKCH-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN4S |
|---|---|
| Molecular weight | 212.66 g/mol |
| IUPAC name | 4-chloro-6-methylsulfanylpyrimido[5,4-d]pyrimidine |
| InChIKey | YBAUXEUJXJTKCH-UHFFFAOYSA-N |
| SMILES | CSC1=NC=C2C(=N1)C(=NC=N2)Cl |
Computed by PubChem (NCBI)