8-Chloro-2-cyclopropylimidazo[1,2-a]pyrazine, 95+%
cas: 1334167-20-2 — see every product listed under this CAS number, including other names
8-Chloro-2-cyclopropylimidazo[1,2-a]pyrazine, 95+% (CAS 1334167-20-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A414823-100mg |
| cas | 1334167-20-2 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 292.50 Pln | |
| Ambeed | 250mg | 464.94 Pln | |
| Ambeed | 1g | 1132.44 Pln | |
| Chemat | 100mg | 323.60 Pln | |
| Chemat | 250mg | 530.00 Pln | |
| Chemat | 1g | 1322.00 Pln | |
| BLDpharm | 100mg | 308.80 Pln | |
| BLDpharm | 250mg | 497.63 Pln | |
| BLDpharm | 1g | 1219.60 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
8-chloro-2-cyclopropylimidazo[1,2-a]pyrazine (CAS 1334167-20-2) is a chemical compound with the molecular formula C9H8ClN3 and a molecular weight of 193.63 g/mol. IUPAC name: 8-chloro-2-cyclopropylimidazo[1,2-a]pyrazine. InChIKey: WCGOEMXKEPQDBS-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3 |
|---|---|
| Molecular weight | 193.63 g/mol |
| IUPAC name | 8-chloro-2-cyclopropylimidazo[1,2-a]pyrazine |
| InChIKey | WCGOEMXKEPQDBS-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CN3C=CN=C(C3=N2)Cl |
Computed by PubChem (NCBI)