cas: 59107-51-6 — see every product listed under this CAS number, including other names
8-Chloronaphthalen-1-amine, 97% (CAS 59107-51-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F611159-1G |
| cas | 59107-51-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 250mg | 91.65 Pln | |
| Fluorochem | 5g | 159.34 Pln | |
| Fluorochem | 10g | 263.47 Pln | |
| Fluorochem | 25g | 508.17 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
8-chloronaphthalen-1-amine (CAS 59107-51-6) is a chemical compound with the molecular formula C10H8ClN and a molecular weight of 177.63 g/mol. IUPAC name: 8-chloronaphthalen-1-amine. InChIKey: LQIZPCZWJJQIKV-UHFFFAOYSA-N.
| Molecular formula | C10H8ClN |
|---|---|
| Molecular weight | 177.63 g/mol |
| IUPAC name | 8-chloronaphthalen-1-amine |
| InChIKey | LQIZPCZWJJQIKV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)N)C(=CC=C2)Cl |
Computed by PubChem (NCBI)