8-Fluoroquinolin-5-ol, 97%
cas: 1261845-15-1 — see every product listed under this CAS number, including other names
8-Fluoroquinolin-5-ol, 97% (CAS 1261845-15-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 50mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A943938-100mg |
| cas | 1261845-15-1 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 2272.75 Pln | |
| Ambeed | 250mg | 3618.88 Pln | |
| BLDpharm | 50mg | 1413.97 Pln | |
| BLDpharm | 100mg | 2441.39 Pln | |
| BLDpharm | 250mg | 3896.43 Pln | |
| Chemat | 50mg | 1034.00 Pln | |
| Chemat | 100mg | 1715.60 Pln | |
| Chemat | 250mg | 2872.40 Pln | |
| Fluorochem | 50mg | 1913.93 Pln | |
| Fluorochem | 100mg | 3194.73 Pln | |
| Fluorochem | 250mg | 5324.18 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
8-fluoroquinolin-5-ol (CAS 1261845-15-1) is a chemical compound with the molecular formula C9H6FNO and a molecular weight of 163.15 g/mol. IUPAC name: 8-fluoroquinolin-5-ol. InChIKey: LKIPMFLIZANNEL-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO |
|---|---|
| Molecular weight | 163.15 g/mol |
| IUPAC name | 8-fluoroquinolin-5-ol |
| InChIKey | LKIPMFLIZANNEL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2N=C1)F)O |
Computed by PubChem (NCBI)
Synonyms:
8-Fluoroquinolin-5-ol, 5-Quinolinol, 8-fluoro-