8-Iodo-1-naphthoic acid, 95%
cas: 13577-19-0 — see every product listed under this CAS number, including other names
8-Iodo-1-naphthoic acid, 95% (CAS 13577-19-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg, 25g. Offered by: Combi-blocks, Ambeed, Chemat, BLDpharm.
| brand | Combi-blocks |
|---|---|
| catalog number | HA-7988-250mg |
| cas | 13577-19-0 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 1g | price on request | |
| Ambeed | 250mg | 236.88 Pln | |
| Ambeed | 1g | 737.50 Pln | |
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 189.20 Pln | |
| Chemat | 1g | 549.20 Pln | |
| Chemat | 5g | 1307.60 Pln | |
| BLDpharm | 100mg | 186.63 Pln | |
| BLDpharm | 250mg | 253.27 Pln | |
| BLDpharm | 1g | 786.41 Pln | |
| BLDpharm | 5g | 1913.80 Pln | |
| Fluorochem | 100mg | 143.72 Pln | |
| Fluorochem | 250mg | 237.43 Pln | |
| Fluorochem | 1g | 747.67 Pln | |
| Fluorochem | 5g | 1830.62 Pln | |
| Fluorochem | 25g | 6193.67 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
8-iodonaphthalene-1-carboxylic acid (CAS 13577-19-0) is a chemical compound with the molecular formula C11H7IO2 and a molecular weight of 298.08 g/mol. IUPAC name: 8-iodonaphthalene-1-carboxylic acid. InChIKey: UEDVMWGDQHAVSS-UHFFFAOYSA-N.
| Molecular formula | C11H7IO2 |
|---|---|
| Molecular weight | 298.08 g/mol |
| IUPAC name | 8-iodonaphthalene-1-carboxylic acid |
| InChIKey | UEDVMWGDQHAVSS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)C(=O)O)C(=CC=C2)I |
Computed by PubChem (NCBI)