CAS 5088-94-8 appears in our catalog under these names: 8–Iod–2–naphthoesaeure, 8-Iodo-2-naphthoic acid, 95%, 8-Iodo-2-naphthoic acid, 97+%. Offered by: GLPBio, Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 250mg.
8-iodonaphthalene-2-carboxylic acid (CAS 5088-94-8) is a chemical compound with the molecular formula C11H7IO2 and a molecular weight of 298.08 g/mol. IUPAC name: 8-iodonaphthalene-2-carboxylic acid. InChIKey: YHJSZTVYBQXYDT-UHFFFAOYSA-N.
| Molecular formula | C11H7IO2 |
|---|---|
| Molecular weight | 298.08 g/mol |
| IUPAC name | 8-iodonaphthalene-2-carboxylic acid |
| InChIKey | YHJSZTVYBQXYDT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=C2)C(=O)O)C(=C1)I |
Computed by PubChem (NCBI)