CAS 91059-40-4 appears in our catalog under these names: 3-Iodonaphthalene-1-carboxylic acid, 97%, 3-Iodonaphthalene-1-carboxylic acid, 3-Iodonaphthalene-1-carboxylic acid, 97%, 97%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 50mg, 0,5g, 100mg, 250mg, 500mg, 1g.
3-iodonaphthalene-1-carboxylic acid (CAS 91059-40-4) is a chemical compound with the molecular formula C11H7IO2 and a molecular weight of 298.08 g/mol. IUPAC name: 3-iodonaphthalene-1-carboxylic acid. InChIKey: KYGGRXQUVAKVFF-UHFFFAOYSA-N.
| Molecular formula | C11H7IO2 |
|---|---|
| Molecular weight | 298.08 g/mol |
| IUPAC name | 3-iodonaphthalene-1-carboxylic acid |
| InChIKey | KYGGRXQUVAKVFF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C=C2C(=O)O)I |
Computed by PubChem (NCBI)