cas: 1498-89-1 — see every product listed under this CAS number, including other names
8-Methoxy-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indoline] (CAS 1498-89-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch118XW3-100mg |
| cas | 1498-89-1 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 150.80 Pln | |
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 1g | 405.20 Pln | |
| Chemat | 5g | 1019.60 Pln | |
| Fluorochem | 100mg | 221.81 Pln | |
| Fluorochem | 250mg | 310.33 Pln | |
| Fluorochem | 1g | 732.05 Pln | |
| Fluorochem | 5g | 2309.62 Pln |
| delivery time | 3 weeks |
|---|
8-methoxy-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole] (CAS 1498-89-1) is a chemical compound with the molecular formula C20H20N2O4 and a molecular weight of 352.4 g/mol. IUPAC name: 8-methoxy-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole]. InChIKey: IZDVWQPIYXTGIF-UHFFFAOYSA-N.
| Molecular formula | C20H20N2O4 |
|---|---|
| Molecular weight | 352.4 g/mol |
| IUPAC name | 8-methoxy-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole] |
| InChIKey | IZDVWQPIYXTGIF-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2N(C13C=CC4=C(O3)C(=CC(=C4)[N+](=O)[O-])OC)C)C |
Computed by PubChem (NCBI)