cas: 22246-83-9 — see every product listed under this CAS number, including other names
8-Methoxy-4,5-dihydro-1H-benzo[b]azepin-2(3H)-one 95% (CAS 22246-83-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A361296-100mg |
| cas | 22246-83-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 236.88 Pln | |
| Ambeed | 250mg | 476.06 Pln | |
| Ambeed | 1g | 1343.81 Pln | |
| Ambeed | 5g | 4525.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A361296 |
8-methoxy-1,3,4,5-tetrahydro-1-benzazepin-2-one (CAS 22246-83-9) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: 8-methoxy-1,3,4,5-tetrahydro-1-benzazepin-2-one. InChIKey: BKZDEMMOMTUSPL-UHFFFAOYSA-N.
| Molecular formula | C11H13NO2 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | 8-methoxy-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| InChIKey | BKZDEMMOMTUSPL-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(CCCC(=O)N2)C=C1 |
Computed by PubChem (NCBI)