cas: 22246-83-9 — see every product listed under this CAS number, including other names
8-Methoxy-4,5-dihydro-1H-benzo[b]azepin-2(3H)-one, 95%, 95% (CAS 22246-83-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BJD7-100mg |
| cas | 22246-83-9 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 184.40 Pln | |
| Chemat | 250mg | 362.00 Pln | |
| Chemat | 500mg | 635.60 Pln | |
| Chemat | 1g | 995.60 Pln | |
| Chemat | 5g | 3482.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
8-methoxy-1,3,4,5-tetrahydro-1-benzazepin-2-one (CAS 22246-83-9) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: 8-methoxy-1,3,4,5-tetrahydro-1-benzazepin-2-one. InChIKey: BKZDEMMOMTUSPL-UHFFFAOYSA-N.
| Molecular formula | C11H13NO2 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | 8-methoxy-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| InChIKey | BKZDEMMOMTUSPL-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(CCCC(=O)N2)C=C1 |
Computed by PubChem (NCBI)