8-Oxa-2-azaspiro[4.5]decane oxalate(2:1), 97%
cas: 1651840-84-4 — see every product listed under this CAS number, including other names
8-Oxa-2-azaspiro[4.5]decane oxalate(2:1), 97% (CAS 1651840-84-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A124060-250mg |
| cas | 1651840-84-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 170.12 Pln | |
| Ambeed | 1g | 270.25 Pln | |
| Ambeed | 5g | 754.19 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 222.80 Pln | |
| Chemat | 5g | 856.40 Pln | |
| BLDpharm | 100mg | 153.30 Pln | |
| BLDpharm | 250mg | 181.07 Pln | |
| BLDpharm | 1g | 286.59 Pln | |
| BLDpharm | 5g | 730.88 Pln | |
| Fluorochem | 1g | 294.71 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Bis(8-oxa-2-azaspiro[4.5]decane);oxalic acid (CAS 1651840-84-4) is a chemical compound with the molecular formula C18H32N2O6 and a molecular weight of 372.5 g/mol. IUPAC name: bis(8-oxa-2-azaspiro[4.5]decane);oxalic acid. InChIKey: XZXYCQCIQSKHHF-UHFFFAOYSA-N.
| Molecular formula | C18H32N2O6 |
|---|---|
| Molecular weight | 372.5 g/mol |
| IUPAC name | bis(8-oxa-2-azaspiro[4.5]decane);oxalic acid |
| InChIKey | XZXYCQCIQSKHHF-UHFFFAOYSA-N |
| SMILES | C1CNCC12CCOCC2.C1CNCC12CCOCC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)