CAS 2306248-08-6 appears in our catalog under these names: (5S)-7-Oxa-2-azaspiro[4.5]decane hemioxalate, 95%, (S)-7-Oxa-2-azaspiro(4.5)decane hemioxalate, 97%, (5S)-7-oxa-2-azaspiro[4.5]decane hemioxalate, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg, 500mg.
Bis((5S)-7-oxa-2-azaspiro[4.5]decane);oxalic acid (CAS 2306248-08-6) is a chemical compound with the molecular formula C18H32N2O6 and a molecular weight of 372.5 g/mol. IUPAC name: bis((5S)-7-oxa-2-azaspiro[4.5]decane);oxalic acid. InChIKey: GHDPJNVTRYZODS-QXGOIDDHSA-N.
| Molecular formula | C18H32N2O6 |
|---|---|
| Molecular weight | 372.5 g/mol |
| IUPAC name | bis((5S)-7-oxa-2-azaspiro[4.5]decane);oxalic acid |
| InChIKey | GHDPJNVTRYZODS-QXGOIDDHSA-N |
| SMILES | C1C[C@@]2(CCNC2)COC1.C1C[C@@]2(CCNC2)COC1.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)