Products 1951444-83-9

CAS 1951444-83-9 is the registry number for 2-Oxa-8-azaspiro[4.5]decane hemioxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

Bis(2-oxa-8-azaspiro[4.5]decane);oxalic acid (CAS 1951444-83-9) is a chemical compound with the molecular formula C18H32N2O6 and a molecular weight of 372.5 g/mol. IUPAC name: bis(2-oxa-8-azaspiro[4.5]decane);oxalic acid. InChIKey: NLHCUGDZDSFXOZ-UHFFFAOYSA-N.

Identity
Molecular formulaC18H32N2O6
Molecular weight372.5 g/mol
IUPAC namebis(2-oxa-8-azaspiro[4.5]decane);oxalic acid
InChIKeyNLHCUGDZDSFXOZ-UHFFFAOYSA-N
SMILESC1CNCCC12CCOC2.C1CNCCC12CCOC2.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)