cas: 1713265-20-3 — see every product listed under this CAS number, including other names
8-Quinolinamine, 5-bromo-N,N-dimethyl-, 97%, 97% (CAS 1713265-20-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JRG8-100mg |
| cas | 1713265-20-3 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 683.60 Pln | |
| Chemat | 250mg | 957.20 Pln | |
| Chemat | 1g | 2128.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-bromo-N,N-dimethylquinolin-8-amine (CAS 1713265-20-3) is a chemical compound with the molecular formula C11H11BrN2 and a molecular weight of 251.12 g/mol. IUPAC name: 5-bromo-N,N-dimethylquinolin-8-amine. InChIKey: HMUPTFCIKPLNCZ-UHFFFAOYSA-N.
| Molecular formula | C11H11BrN2 |
|---|---|
| Molecular weight | 251.12 g/mol |
| IUPAC name | 5-bromo-N,N-dimethylquinolin-8-amine |
| InChIKey | HMUPTFCIKPLNCZ-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C2C(=C(C=C1)Br)C=CC=N2 |
Computed by PubChem (NCBI)