cas: 65340-75-2 — see every product listed under this CAS number, including other names
8-bromo-4-quinolinamine, 97% (CAS 65340-75-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F311442-250MG |
| cas | 65340-75-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 289.50 Pln | |
| Fluorochem | 1g | 690.40 Pln | |
| Fluorochem | 5g | 2715.73 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
8-bromoquinolin-4-amine (CAS 65340-75-2) is a chemical compound with the molecular formula C9H7BrN2 and a molecular weight of 223.07 g/mol. IUPAC name: 8-bromoquinolin-4-amine. InChIKey: IYDRVHGHAXAOGC-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2 |
|---|---|
| Molecular weight | 223.07 g/mol |
| IUPAC name | 8-bromoquinolin-4-amine |
| InChIKey | IYDRVHGHAXAOGC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2C(=C1)Br)N |
Computed by PubChem (NCBI)