cas: 76275-14-4 — see every product listed under this CAS number, including other names
9,10-Dibutoxyanthracene 95% (CAS 76275-14-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A234523-250mg |
| cas | 76275-14-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 220.19 Pln | |
| Ambeed | 5g | 770.88 Pln | |
| Ambeed | 10g | 1466.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A234523 |
9,10-dibutoxyanthracene (CAS 76275-14-4) is a chemical compound with the molecular formula C22H26O2 and a molecular weight of 322.4 g/mol. IUPAC name: 9,10-dibutoxyanthracene. InChIKey: KSMGAOMUPSQGTB-UHFFFAOYSA-N.
| Molecular formula | C22H26O2 |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | 9,10-dibutoxyanthracene |
| InChIKey | KSMGAOMUPSQGTB-UHFFFAOYSA-N |
| SMILES | CCCCOC1=C2C=CC=CC2=C(C3=CC=CC=C31)OCCCC |
Computed by PubChem (NCBI)