cas: 76275-14-4 — see every product listed under this CAS number, including other names
9,10-Dibutoxyanthracene, 97%, 97% (CAS 76275-14-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1147HS-100mg |
| cas | 76275-14-4 |
| size | 100mg |
| availability | 72.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 170.00 Pln | |
| Chemat | 10g | 270.80 Pln | |
| Chemat | 25g | 544.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
9,10-dibutoxyanthracene (CAS 76275-14-4) is a chemical compound with the molecular formula C22H26O2 and a molecular weight of 322.4 g/mol. IUPAC name: 9,10-dibutoxyanthracene. InChIKey: KSMGAOMUPSQGTB-UHFFFAOYSA-N.
| Molecular formula | C22H26O2 |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | 9,10-dibutoxyanthracene |
| InChIKey | KSMGAOMUPSQGTB-UHFFFAOYSA-N |
| SMILES | CCCCOC1=C2C=CC=CC2=C(C3=CC=CC=C31)OCCCC |
Computed by PubChem (NCBI)