cas: 76275-14-4 — see every product listed under this CAS number, including other names
9,10-Dibutoxyanthracene, >95.0%(HPLC) (CAS 76275-14-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D4515-1G |
| cas | 76275-14-4 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 226.52 Pln | |
| TCI | 5g | 733.00 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >95.0%(HPLC) |
9,10-dibutoxyanthracene (CAS 76275-14-4) is a chemical compound with the molecular formula C22H26O2 and a molecular weight of 322.4 g/mol. IUPAC name: 9,10-dibutoxyanthracene. InChIKey: KSMGAOMUPSQGTB-UHFFFAOYSA-N.
| Molecular formula | C22H26O2 |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | 9,10-dibutoxyanthracene |
| InChIKey | KSMGAOMUPSQGTB-UHFFFAOYSA-N |
| SMILES | CCCCOC1=C2C=CC=CC2=C(C3=CC=CC=C31)OCCCC |
Computed by PubChem (NCBI)