9-(4-Bromophenyl)-10-(naphthalen-2-yl)anthracene, 97%
cas: 936854-62-5 — see every product listed under this CAS number, including other names
9-(4-Bromophenyl)-10-(naphthalen-2-yl)anthracene, 97% (CAS 936854-62-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A872718-250mg |
| cas | 936854-62-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 375.94 Pln | |
| Ambeed | 5g | 1115.75 Pln | |
| Ambeed | 10g | 1861.13 Pln | |
| BLDpharm | 250mg | 203.29 Pln | |
| BLDpharm | 1g | 403.22 Pln | |
| BLDpharm | 5g | 1197.38 Pln | |
| BLDpharm | 10g | 1997.10 Pln | |
| Chemat | 250mg | 189.20 Pln | |
| Chemat | 1g | 390.80 Pln | |
| Chemat | 5g | 1149.20 Pln | |
| Chemat | 10g | 1912.40 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
9-(4-bromophenyl)-10-naphthalen-2-ylanthracene (CAS 936854-62-5) is a chemical compound with the molecular formula C30H19Br and a molecular weight of 459.4 g/mol. IUPAC name: 9-(4-bromophenyl)-10-naphthalen-2-ylanthracene. InChIKey: MWIMXPOBAUIYCW-UHFFFAOYSA-N.
| Molecular formula | C30H19Br |
|---|---|
| Molecular weight | 459.4 g/mol |
| IUPAC name | 9-(4-bromophenyl)-10-naphthalen-2-ylanthracene |
| InChIKey | MWIMXPOBAUIYCW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C3=C4C=CC=CC4=C(C5=CC=CC=C53)C6=CC=C(C=C6)Br |
Computed by PubChem (NCBI)