Products 2396648-76-1
CAS 2396648-76-1 is the registry number for 9-Bromo-10-(7-phenyl-2-naphthalenyl)anthracene, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
9-bromo-10-(7-phenylnaphthalen-2-yl)anthracene (CAS 2396648-76-1) is a chemical compound with the molecular formula C30H19Br and a molecular weight of 459.4 g/mol. IUPAC name: 9-bromo-10-(7-phenylnaphthalen-2-yl)anthracene. InChIKey: NVBWCONCBRXMFG-UHFFFAOYSA-N.
| Molecular formula | C30H19Br |
|---|---|
| Molecular weight | 459.4 g/mol |
| IUPAC name | 9-bromo-10-(7-phenylnaphthalen-2-yl)anthracene |
| InChIKey | NVBWCONCBRXMFG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=C(C=C2)C=CC(=C3)C4=C5C=CC=CC5=C(C6=CC=CC=C64)Br |
Computed by PubChem (NCBI)