Products 1228267-67-1
CAS 1228267-67-1 is the registry number for 9-(3-Bromophenyl)-10-(naphthalen-1-yl)anthracene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
9-(3-bromophenyl)-10-naphthalen-1-ylanthracene (CAS 1228267-67-1) is a chemical compound with the molecular formula C30H19Br and a molecular weight of 459.4 g/mol. IUPAC name: 9-(3-bromophenyl)-10-naphthalen-1-ylanthracene. InChIKey: ILTZJMLOBDINIK-UHFFFAOYSA-N.
| Molecular formula | C30H19Br |
|---|---|
| Molecular weight | 459.4 g/mol |
| IUPAC name | 9-(3-bromophenyl)-10-naphthalen-1-ylanthracene |
| InChIKey | ILTZJMLOBDINIK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C3=C4C=CC=CC4=C(C5=CC=CC=C53)C6=CC(=CC=C6)Br |
Computed by PubChem (NCBI)