cas: 1233323-61-9 — see every product listed under this CAS number, including other names
9-[(tert-butoxy)carbonyl]-3-oxa-9-azabicyclo[3.3.1]nonane-7-carboxylic acid, 97% (CAS 1233323-61-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F517199-100MG |
| cas | 1233323-61-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 2439.78 Pln | |
| Fluorochem | 250mg | 3861.16 Pln | |
| Fluorochem | 500mg | 6375.90 Pln | |
| Fluorochem | 1g | 9525.83 Pln | |
| Fluorochem | 5g | 28435.84 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
9-[(2-methylpropan-2-yl)oxycarbonyl]-3-oxa-9-azabicyclo[3.3.1]nonane-7-carboxylic acid (CAS 1233323-61-9) is a chemical compound with the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. IUPAC name: 9-[(2-methylpropan-2-yl)oxycarbonyl]-3-oxa-9-azabicyclo[3.3.1]nonane-7-carboxylic acid. InChIKey: OVNHULFEMHFUNY-UHFFFAOYSA-N.
| Molecular formula | C13H21NO5 |
|---|---|
| Molecular weight | 271.31 g/mol |
| IUPAC name | 9-[(2-methylpropan-2-yl)oxycarbonyl]-3-oxa-9-azabicyclo[3.3.1]nonane-7-carboxylic acid |
| InChIKey | OVNHULFEMHFUNY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2CC(CC1COC2)C(=O)O |
Computed by PubChem (NCBI)