CAS 141779-77-3 is the registry number for 9-Azido-nonanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
9-azidononanoic acid (CAS 141779-77-3) is a chemical compound with the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. IUPAC name: 9-azidononanoic acid. InChIKey: CDKGQZWXTZZOCD-UHFFFAOYSA-N.
| Molecular formula | C9H17N3O2 |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | 9-azidononanoic acid |
| InChIKey | CDKGQZWXTZZOCD-UHFFFAOYSA-N |
| SMILES | C(CCCCN=[N+]=[N-])CCCC(=O)O |
Computed by PubChem (NCBI)