CAS 1316857-47-2 is the registry number for 5-Azido-1,1-dimethylethylester Pentanoic Acid. Offered by: TRC. Available pack sizes: 2,5g.
Tert-butyl 5-azidopentanoate (CAS 1316857-47-2) is a chemical compound with the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. IUPAC name: tert-butyl 5-azidopentanoate. InChIKey: XCFLKHUSECTJHM-UHFFFAOYSA-N.
| Molecular formula | C9H17N3O2 |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | tert-butyl 5-azidopentanoate |
| InChIKey | XCFLKHUSECTJHM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCCCN=[N+]=[N-] |
Computed by PubChem (NCBI)