CAS 1401666-86-1 is the registry number for N-((S)-1-((S)-2-Aminopropanoyl)pyrrolidin-3-yl)acetamide, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(3S)-1-[(2S)-2-aminopropanoyl]pyrrolidin-3-yl]acetamide (CAS 1401666-86-1) is a chemical compound with the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. IUPAC name: N-[(3S)-1-[(2S)-2-aminopropanoyl]pyrrolidin-3-yl]acetamide. InChIKey: LFRKYDWIYDBMTC-XPUUQOCRSA-N.
| Molecular formula | C9H17N3O2 |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | N-[(3S)-1-[(2S)-2-aminopropanoyl]pyrrolidin-3-yl]acetamide |
| InChIKey | LFRKYDWIYDBMTC-XPUUQOCRSA-N |
| SMILES | C[C@@H](C(=O)N1CC[C@@H](C1)NC(=O)C)N |
Computed by PubChem (NCBI)