cas: 15364-55-3 — see every product listed under this CAS number, including other names
9-BRomo-9,10-dihydro-9,10-[1,2]benzenoanthracene, 98%, 98% (CAS 15364-55-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ADWF-100mg |
| cas | 15364-55-3 |
| size | 100mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 203.60 Pln | |
| Chemat | 1g | 414.80 Pln | |
| Chemat | 5g | 1230.80 Pln | |
| Chemat | 10g | 2166.80 Pln | |
| Chemat | 25g | 4274.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-bromopentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaene (CAS 15364-55-3) is a chemical compound with the molecular formula C20H13Br and a molecular weight of 333.2 g/mol. IUPAC name: 1-bromopentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaene. InChIKey: HSROKCVTEYMWHO-UHFFFAOYSA-N.
| Molecular formula | C20H13Br |
|---|---|
| Molecular weight | 333.2 g/mol |
| IUPAC name | 1-bromopentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaene |
| InChIKey | HSROKCVTEYMWHO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3C4=CC=CC=C4C2(C5=CC=CC=C35)Br |
Computed by PubChem (NCBI)