CAS 33735-95-4 appears in our catalog under these names: 9-[Bromo(phenyl)methylene]-9h-fluorene, 95%, 9-(Bromo(phenyl)methylene)-9H-fluorene. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 100mg, 250mg, 500mg, 1000mg.
9-[bromo(phenyl)methylidene]fluorene (CAS 33735-95-4) is a chemical compound with the molecular formula C20H13Br and a molecular weight of 333.2 g/mol. IUPAC name: 9-[bromo(phenyl)methylidene]fluorene. InChIKey: GMFPCFIMQWGRRD-UHFFFAOYSA-N.
| Molecular formula | C20H13Br |
|---|---|
| Molecular weight | 333.2 g/mol |
| IUPAC name | 9-[bromo(phenyl)methylidene]fluorene |
| InChIKey | GMFPCFIMQWGRRD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=C2C3=CC=CC=C3C4=CC=CC=C42)Br |
Computed by PubChem (NCBI)