CAS 15364-55-3 appears in our catalog under these names: 9-Bromo-9,10-dihydro-9,10-[1,2]benzenoanthracene, 95%, 9-Bromo-9,10-dihydro-9,10-(1,2)benzenoanthracene, 9–Bromotriptycene, 9-Bromotriptycene, >98.0%(GC), 9-BRomo-9,10-dihydro-9,10-[1,2]benzenoanthracene, 98%, 98%. Offered by: Combi-blocks, TRC, GLPBio, TCI, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg, 10g, 25g.
1-bromopentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaene (CAS 15364-55-3) is a chemical compound with the molecular formula C20H13Br and a molecular weight of 333.2 g/mol. IUPAC name: 1-bromopentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaene. InChIKey: HSROKCVTEYMWHO-UHFFFAOYSA-N.
| Molecular formula | C20H13Br |
|---|---|
| Molecular weight | 333.2 g/mol |
| IUPAC name | 1-bromopentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaene |
| InChIKey | HSROKCVTEYMWHO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3C4=CC=CC=C4C2(C5=CC=CC=C35)Br |
Computed by PubChem (NCBI)