cas: 500360-86-1 — see every product listed under this CAS number, including other names
9-Benzyl-3,9-diazaspiro[5.5]undecan-2-one, 97%, 97% (CAS 500360-86-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DG64-100mg |
| cas | 500360-86-1 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 827.60 Pln | |
| Chemat | 250mg | 1086.80 Pln | |
| Chemat | 500mg | 1773.20 Pln | |
| Chemat | 1g | 2622.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-benzyl-3,9-diazaspiro[5.5]undecan-10-one (CAS 500360-86-1) is a chemical compound with the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. IUPAC name: 3-benzyl-3,9-diazaspiro[5.5]undecan-10-one. InChIKey: NDDZYCRYGWSPSJ-UHFFFAOYSA-N.
| Molecular formula | C16H22N2O |
|---|---|
| Molecular weight | 258.36 g/mol |
| IUPAC name | 3-benzyl-3,9-diazaspiro[5.5]undecan-10-one |
| InChIKey | NDDZYCRYGWSPSJ-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)CC12CCN(CC2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)