CAS 227953-47-1 is the registry number for Oxymetazoline Impurity 6. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
6-tert-butyl-3-(1H-imidazol-2-ylmethyl)-2,4-dimethylphenol (CAS 227953-47-1) is a chemical compound with the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. IUPAC name: 6-tert-butyl-3-(1H-imidazol-2-ylmethyl)-2,4-dimethylphenol. InChIKey: KDWBYTYXTYYVEX-UHFFFAOYSA-N.
| Molecular formula | C16H22N2O |
|---|---|
| Molecular weight | 258.36 g/mol |
| IUPAC name | 6-tert-butyl-3-(1H-imidazol-2-ylmethyl)-2,4-dimethylphenol |
| InChIKey | KDWBYTYXTYYVEX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1CC2=NC=CN2)C)O)C(C)(C)C |
Computed by PubChem (NCBI)