Products 227953-47-1

CAS 227953-47-1 is the registry number for Oxymetazoline Impurity 6. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

6-tert-butyl-3-(1H-imidazol-2-ylmethyl)-2,4-dimethylphenol (CAS 227953-47-1) is a chemical compound with the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. IUPAC name: 6-tert-butyl-3-(1H-imidazol-2-ylmethyl)-2,4-dimethylphenol. InChIKey: KDWBYTYXTYYVEX-UHFFFAOYSA-N.

Identity
Molecular formulaC16H22N2O
Molecular weight258.36 g/mol
IUPAC name6-tert-butyl-3-(1H-imidazol-2-ylmethyl)-2,4-dimethylphenol
InChIKeyKDWBYTYXTYYVEX-UHFFFAOYSA-N
SMILESCC1=CC(=C(C(=C1CC2=NC=CN2)C)O)C(C)(C)C

Computed by PubChem (NCBI)