Products 2760489-44-7
CAS 2760489-44-7 is the registry number for 1-Methyl-6-(5-methylpiperidin-2-yl)-3,4-dihydroquinolin-2(1H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-methyl-6-(5-methylpiperidin-2-yl)-3,4-dihydroquinolin-2-one (CAS 2760489-44-7) is a chemical compound with the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. IUPAC name: 1-methyl-6-(5-methylpiperidin-2-yl)-3,4-dihydroquinolin-2-one. InChIKey: KDLDXYHRECEZLE-UHFFFAOYSA-N.
| Molecular formula | C16H22N2O |
|---|---|
| Molecular weight | 258.36 g/mol |
| IUPAC name | 1-methyl-6-(5-methylpiperidin-2-yl)-3,4-dihydroquinolin-2-one |
| InChIKey | KDLDXYHRECEZLE-UHFFFAOYSA-N |
| SMILES | CC1CCC(NC1)C2=CC3=C(C=C2)N(C(=O)CC3)C |
Computed by PubChem (NCBI)