cas: 1023595-19-8 — see every product listed under this CAS number, including other names
9-Boc-2,9-diazaspiro[5.5]undecane 97% (CAS 1023595-19-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A154872-250mg |
| cas | 1023595-19-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 337.00 Pln | |
| Ambeed | 5g | 637.38 Pln | |
| Ambeed | 25g | 2055.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A154872 |
Tert-butyl 2,9-diazaspiro[5.5]undecane-9-carboxylate (CAS 1023595-19-8) is a chemical compound with the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. IUPAC name: tert-butyl 2,9-diazaspiro[5.5]undecane-9-carboxylate. InChIKey: QDWTYWWOUAIWGI-UHFFFAOYSA-N.
| Molecular formula | C14H26N2O2 |
|---|---|
| Molecular weight | 254.37 g/mol |
| IUPAC name | tert-butyl 2,9-diazaspiro[5.5]undecane-9-carboxylate |
| InChIKey | QDWTYWWOUAIWGI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCCNC2)CC1 |
Computed by PubChem (NCBI)