9-Oxo-9H-thioxanthene-2-carboxylic acid, 97%
cas: 25095-94-7 — see every product listed under this CAS number, including other names
9-Oxo-9H-thioxanthene-2-carboxylic acid, 97% (CAS 25095-94-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25mg. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F626591-100MG |
| cas | 25095-94-7 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 674.78 Pln | |
| Fluorochem | 250mg | 976.76 Pln | |
| Fluorochem | 1g | 2294.00 Pln | |
| Ambeed | 250mg | 548.38 Pln | |
| Ambeed | 1g | 1260.38 Pln | |
| Ambeed | 5g | 5120.75 Pln | |
| Chemat | 25mg | 184.40 Pln | |
| Chemat | 100mg | 366.80 Pln | |
| Chemat | 250mg | 520.40 Pln | |
| Chemat | 1g | 1211.60 Pln | |
| BLDpharm | 100mg | 414.32 Pln | |
| BLDpharm | 250mg | 580.93 Pln | |
| BLDpharm | 1g | 1352.88 Pln | |
| BLDpharm | 5g | 5018.26 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
9-oxothioxanthene-2-carboxylic acid (CAS 25095-94-7) is a chemical compound with the molecular formula C14H8O3S and a molecular weight of 256.28 g/mol. IUPAC name: 9-oxothioxanthene-2-carboxylic acid. InChIKey: PPFNJKRRFYQNLD-UHFFFAOYSA-N.
| Molecular formula | C14H8O3S |
|---|---|
| Molecular weight | 256.28 g/mol |
| IUPAC name | 9-oxothioxanthene-2-carboxylic acid |
| InChIKey | PPFNJKRRFYQNLD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(S2)C=CC(=C3)C(=O)O |
Computed by PubChem (NCBI)