Products 51762-56-2

CAS 51762-56-2 is the registry number for 9-Oxo-9H-Thioxanthene-4-carboxylic Acid, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.

Structural formula: {0} (CAS {1})

9-oxothioxanthene-4-carboxylic acid (CAS 51762-56-2) is a chemical compound with the molecular formula C14H8O3S and a molecular weight of 256.28 g/mol. IUPAC name: 9-oxothioxanthene-4-carboxylic acid. InChIKey: OTPIPHJWVKNZOA-UHFFFAOYSA-N.

Identity
Molecular formulaC14H8O3S
Molecular weight256.28 g/mol
IUPAC name9-oxothioxanthene-4-carboxylic acid
InChIKeyOTPIPHJWVKNZOA-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=O)C3=C(S2)C(=CC=C3)C(=O)O

Computed by PubChem (NCBI)