CAS 51762-56-2 is the registry number for 9-Oxo-9H-Thioxanthene-4-carboxylic Acid, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.
9-oxothioxanthene-4-carboxylic acid (CAS 51762-56-2) is a chemical compound with the molecular formula C14H8O3S and a molecular weight of 256.28 g/mol. IUPAC name: 9-oxothioxanthene-4-carboxylic acid. InChIKey: OTPIPHJWVKNZOA-UHFFFAOYSA-N.
| Molecular formula | C14H8O3S |
|---|---|
| Molecular weight | 256.28 g/mol |
| IUPAC name | 9-oxothioxanthene-4-carboxylic acid |
| InChIKey | OTPIPHJWVKNZOA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(S2)C(=CC=C3)C(=O)O |
Computed by PubChem (NCBI)